Wêdakakêna Urolithin B

November 9, 2020

Cofttek minangka produsen bubuk Urolithin B paling apik ing China. Pabrik kita duwe sistem manajemen produksi lengkap (ISO9001 & ISO14001), kanthi kapasitas produksi saben wulan 200kg.

 


status: Ing Produksi Massa
Unit: 1kg / tas, 25kg / Dram

Urolithin BSpambocoran

Jeneng: Urolithin B
Jeneng kimia: 3-Hydroxy-6H-dibenzo [b, d] pyran-6-siji
CAS: 1139-83-9
Formula Kimia: C13H8O3
Bobot molekul: 212.2 g / mol
warna:  wêdakakêna putih
Kunci InChi: WXUQMTRHPNOXBV-UHFFFAOYSA-N
Kode SMILES: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
fungsi: Urolithin B bisa nambah fungsi mitokondria lan otot.

Urolithin B bisa nambah kekuatan otot lan ketahanan nalika tuwa.

aplikasi: Urolithin B minangka metabolit mikroba ing usus ellagitannis lan nampilake aktifitas anti-oksidan lan pro-oksidan gumantung karo sistem lan syarat assay. Urolithin B uga bisa nampilake kegiatan estrogenik lan / utawa anti-estrogenik.
Kelarutan: Larut kanthi gampang ing N, N-dimethylformamide lan dimethylmethylene. Sulfone, rada larut ing metanol, etanol, lan etil asetat
Panyimpenan Temp: Hygroscopic, -20 ° C Freezer, Ing atmosfer inert
Kondisi Pangiriman: Diluncurake ing suhu lingkungan minangka bahan kimia sing ora berbahaya. Prodhuk iki cukup stabil kanggo sawetara minggu nalika pengiriman biasa lan wektu ditindakake ing Bea Cukai.

 

Urolithin B Spektrum NMR

Urolithin B (1139-83-9) - Spektrum NMR

 

Yen sampeyan butuh COA, MSDS, HNMR kanggo saben produk lan informasi liyane, hubungi kami pimpinan Pemasaran.

 

Pambuka kanggo Urolithins

Urolithin minangka metabolit sekunder asam ellagic sing asale saka ellagitannins. Ing manungsa ellagitannins diowahi dening microflora usus dadi asam ellagic sing banjur malih dadi urolithin A, urolithin B, urolithin C lan urolithin D ing usus gedhe.

Urolithin A (UA) minangka metabolit ellagitannin sing paling umum. Nanging, urolithin A ora dingerteni kedadeyan alami ing sumber diet.

Urolithin B (UB) minangka metabolit sing akeh sing diproduksi ing usus liwat transformasi ellagitanin. Urolithin B minangka produk pungkasan sawise turunan urolithin liyane katabolisasi. Urolithin B ditemokake ing urin minangka urolithin B glukuronida.

Urolithin: A 8-Methyl Ether minangka produk menengah sajrone sintesis Urolithin A. Iki minangka metabolit sekunder sing penting kanggo ellagitannin lan nduweni sifat antioksidan lan anti-inflamasi.

 

Mekanisme tumindak urolithin A lan B

● Urolithin A nyebabake mitofagy

Mitophagy minangka salah sawijining bentuk autofagy sing mbantu ngilangi mitokondria sing rusak kanggo fungsi sing optimal. Autofagy nuduhake proses umum sing konten sitoplasma diremehake lan bisa dikitar maneh nalika mitophagy yaiku rusak lan daur ulang mitokondria.

Sajrone tuwa, penurunan autofagia minangka salah sawijining aspek sing nyebabake penurunan fungsi mitokondria. Sabanjure, stres oksidatif uga bisa nyebabake autofag kurang. Urolithin A duwe kemampuan ngilangi mitokondria sing rusak liwat autofagia selektif.

● sifat antioksidan

Tekanan oksidatif ana nalika ora seimbang antara radikal bebas lan antioksidan ing awak. Radikal bebas keluwihan iki asring ana gandhengane karo penyakit nemen, penyakit jantung, diabetes lan kanker.

Urolithins A lan B nampilake efek antioksidan kanthi kemampuan kanggo nyuda radikal bebas lan khusus tingkat spesies oksigen reaktif intraselular (ROS) lan uga nyandhet peroksida lipid ing jinis sel tartamtu.

Luwih saka iku, urolithin bisa nyegah sawetara enzim oksidasi, kalebu monoamine oxidase A lan tyrosinase.

● sifat anti-natoni

Peradangan minangka proses alami ing endi awak kita nglawan apa wae sing tiba kayata infeksi, ciloko, lan mikroba. Nanging, peradangan kronis bisa mbebayani awak amarga iki ana gegayutan karo macem-macem kelainan kayata panandhang asma, masalah jantung, lan kanker. Peradangan kronis bisa uga amarga radhang akut sing ora diobati, infeksi utawa uga radikal bebas ing awak.

Urolithins A lan B nampilake sifat anti-inflamasi kanthi nyandhet produksi oksida nitrik. Dheweke khusus nyegah obat nitrat oxid synthase (iNOS) sing ora bisa diatasi lan ekspresi mRNA sing tanggung jawab kanggo inflamasi.

● Efek anti-mikroba

Mikroba kalebu bakteri, jamur lan virus kedadeyan kanthi alami ing lingkungan lan uga ing awak manungsa. Nanging, sawetara mikroba sing diarani patogen bisa nyebabake penyakit infeksi kayata flu, campak lan malaria.

Urolithin A lan B bisa nampilake kegiatan antimikroba kanthi nyegah sensasi korum. Sensing korum minangka mode komunikasi bakteri sing ndadekake bakteri bisa ndeteksi lan ngontrol proses sing gegandhengan karo infeksi kayata virulitas lan motilitas.

● Nyandhet glikasi protein

Glikasi nuduhake lampiran gula sing dudu enzim ing lipid utawa protein. Minangka biomarker utama ing diabetes lan kelainan liyane uga tuwa.

Glycation protein dhuwur minangka efek sekunder saka hiperglikemia duwe peran utama ing kelainan sing gegandhengan karo jantung kayata diabetes lan penyakit Alzheimer.

Urolithin A lan B duweni sifat anti-glikatif sing gumantung karo dosis sing bebas saka kegiatan antioksidan.

 

Mupangat Urolithin B

Suplemen Urolithin B uga duwe sawetara mupangat kesehatan lan umume padha karo mupangat urolithin A.

(1) Potensi anti kanker
Sifat anti-inflamasi urolithin B ndadekake calon apik kanggo nglawan kanker. Sawetara peneliti wis nglaporake potensial kasebut ing fibroblasts, mikrofag lan sel endothelial.

Panaliten nglaporake yen UB nyegah macem-macem jinis kanker kayata prostat, usus besar lan kanker kandung kemih.

Ing panaliten sing nglibatake sel kanker usus manungsa, ellagitannins, asam ellagic lan urolithins A lan B dinilai kanthi potensial anti-kanker. Dheweke nglaporake yen kabeh perawatan bisa nyegah nyuda sel kanker. Dheweke nyegah proliferasi sel kanker liwat penangkapan siklus sel ing macem-macem fase lan uga nggunakake apoptosis.

(2) Bisa mbantu nglawan stres oksidatif
Urolithin B nduweni sifat antioksidan sing apik liwat nyuda tingkat spesies oksigen reaktif lan peroksidasi lipid ing jinis sel tartamtu. Tingkat ROS sing ana gandhengane karo akeh kelainan kayata penyakit Alzheimer.

Ing panliten karo sel saraf sing kena stres oksidatif, suplemen urolithin B uga urolithin A ditemokake kanggo nglindhungi sel-sel saka oksidasi mula nambah sel slamet.

(3) Urolithin B ing memori nambah
Urolithin b wis dilaporake kanggo nambah permeabilitas getih-penghalang. Iki nambah fungsi kognitif.

Panliten nuduhake yen urolithin B bisa dadi paningkatan memori potensial kanthi nambah fungsi kognitif umum.

(4) Nyegah gangguan otot
Kekalahan otot bisa kedadeyan amarga ana macem-macem sebab kayata gangguan, tuwa lan kekurangan protein ing diet. Sawetara langkah kanggo mungkasi, matesi utawa luwih becik nyegah kerusakan otot kalebu, olahraga, obat-obatan lan asam amino uga polyphenol bisa digunakake.

Urolithins bisa diklasifikasikake minangka polyphenol lan peran peran kanggo nyegah kekalahan otot kanthi ngaktifake sintesis protein otot lan uga saya mudhun.

Ing panaliten karo tikus, suplemen Urolithin B sing diwenehake sajrone wektu, bisa ningkatake pangembangan otot amarga otot katon luwih gedhe.

(5) Urolithin B nglawan peradangan
Urolithin B duweni sifat anti-inflamasi kanthi nyuda tandha-tandha peradangan.

Ing panelitian tikus kanthi fibrosis ginjel sing kena pengaruh, urolithin B ditemokake ameliorate cedera ginjel. Iki nambah fungsi ginjel, morfologi ginjel uga nyuda spidol ginjel. Iki nuduhake yen UB bisa nyuda radang ginjel.

(6) Mupangat sinergis saka urolithin A lan B
Efek sinergis uga wis dilaporake ing kombinasi urolithin A lan B ing fungsi kognitif lan kapasitas. Panliten kasebut nyatakake manawa kombinasi iki bisa digunakake kanggo nambani utawa nyegah kelainan sing gegandhengan karo dimensia kayata kuatir utawa kelainan Alzheimer.

Mupangat liyane sing ana gandhengane karo urolithins yaiku;

  • neuroprotection
  • Sindrom metabolik ameliorates

 

Sumber panganan Urolithin A lan B

Urolithins ora ditemokake kanthi alami ing sembarang sumber panganan. Iki minangka produk transformasi asam ellagik sing asale saka ellagitannins. Ellagitannins diowahi dadi asam ellagic dening microbiota usus lan asam ellagik terus diowahi dadi metabolit (urolithins) ing usus gedhe.

Ellagitannins kedadeyan kanthi alami ing sumber panganan kayata pomegranates, woh wohan kalebu stroberi, raspberry, cloudberry lan blackberry, anggur muscadine, almond, jambu biji, teh, lan kacang-kacangan kayata kenari lan kastanye uga omben-omben umur oak, kayata anggur abang lan wiski saka tong oak.

Mula, kita bisa nyimpulake panganan urolithin A lan panganan urolithin B yaiku panganan sing akeh ellagitannin. Perlu dielingi manawa bioavailabilitas ellagitannin diwatesi banget nalika metabolit sekunder (urolithin) wis gampang kasedhiya.

Ekskresi lan produksi urolithin beda-beda beda-beda ing antarane individu amarga konversi saka ellagitanin gumantung karo mikrobiota ing usus. Ana bakteri khusus sing melu konversi kasebut lan beda-beda ing antarane individu sing sawetara duwe mikrobiota sing cocog, kurang utawa ora kasedhiya. Sumber panganan uga beda-beda ing level ellagitannins. Mula, mupangat potensial ellagitannins beda-beda gumantung saka siji individu liyane.

 

Suplemen Urolithin A lan B

Suplemen Urolithin A uga suplemen Urolithin B gampang ditemokake ing pasar minangka suplemen sumber panganan sing akeh ellagitannin. Suplemen Urolithin A uga kasedhiya. Umume suplemen buah delima wis didol lan digunakake kanthi sukses. Suplemen iki disintesis saka woh-wohan utawa kacang-kacangan lan dirumusake dadi bentuk cair utawa bubuk.

Amarga variasi konsentrasi ellagitanin ing macem-macem panganan, pelanggan urolithin bisa tuku sumber bahan panganan kasebut. Iki uga ditrapake nalika golek bubuk urolithin B utawa suplemen cair.

Sawetara studi klinis manungsa sing dilakoni karo bubuk urolithin A utawa B durung nglaporake efek samping serius saka administrasi suplemen kasebut.

reference

  1. Garcia-Muñoz, Cristina; Vaillant, Fabrice (2014-12-02). "Nasib Metabolic Ellagitannins: Implikasi kanggo Kesehatan, lan Perspektif Riset kanggo Panganan Fungsional Inovatif". Ulasan Kritik ing Ilmu Pangan lan Nutrisi.
  2. Bialonska D, Kasimsetty SG, Khan SI, Ferreira D (11 November 2009). "Urolithins, metabolit mikroba usus ellagitanin Delima, nuduhake kegiatan antioksidan kuat ing tes adhedhasar sel". J Agric Food Chem.
  3. Bodwell, Graham; Pottie, Ian; Nandaluru, Penchal (2011). "Sintesis Total Dianggo Kanthi Elektron-Panjaluk-Sintesis Urolithin M7".