Urolithin B (1139-83-9) Pabrik pabrikan

Urolithin B

November 9, 2020

Urolithin BSpambocoran

Jeneng: Urolithin B
Jeneng kimia: 3-Hydroxy-6H-dibenzo [b, d] pyran-6-siji
CAS: 1139-83-9
Formula Kimia: C13H8O3
Bobot molekul: 212.2 g / mol
warna:  wêdakakêna putih
Kunci InChi: WXUQMTRHPNOXBV-UHFFFAOYSA-N
Kode SMILES: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
fungsi: Urolithin B bisa nambah fungsi mitokondria lan otot.

Urolithin B bisa nambah kekuatan otot lan ketahanan nalika tuwa.

aplikasi: Urolithin B minangka metabolit mikroba ing usus ellagitannis lan nampilake aktifitas anti-oksidan lan pro-oksidan gumantung karo sistem lan syarat assay. Urolithin B uga bisa nampilake kegiatan estrogenik lan / utawa anti-estrogenik.
Kelarutan: Larut kanthi gampang ing N, N-dimethylformamide lan dimethylmethylene. Sulfone, rada larut ing metanol, etanol, lan etil asetat
Panyimpenan Temp: Hygroscopic, -20 ° C Freezer, Ing atmosfer inert
Kondisi Pangiriman: Diluncurake ing suhu lingkungan minangka bahan kimia sing ora berbahaya. Prodhuk iki cukup stabil kanggo sawetara minggu nalika pengiriman biasa lan wektu ditindakake ing Bea Cukai.